Natamycin

Natamycin
Molecular formula: C33H47NO13 （M.W. 665.73）
Application
Natamycin, also known as pimaricin, is an antifungal agent with broad spectrum. It can inhibit the growth of various moulds and yeast as well as the generation of fungal-toxin. For the treatment of fungal blepharitis, conjunctivitis, and keratitis caused by susceptible organisms including Fusarium solani keratitis.
Contact person: Mr.Toby
E-mail: toby(at)international-biz.com
MSN: api20120702(at)hotmial.com
Skype: api20120702
QQ: 2653090857

Offers list from this company:

1. [Sell] Sodium fusidate
   
2. [Sell] Norvancomycin Hydrochloride
   
3. [Sell] Rapamycin
   
4. [Sell] Micafungin
   
5. [Sell] Everolimus
   
6. [Sell] Echinocandin B
   
7. [Sell] Deforolimus
   
8. [Sell] Anidulafungin
   
9. [Sell] Natamycin
   
10. [Sell] Fusidine
    
11. [Sell] Daptomycin
    
12. [Sell] Teicoplanin
    
13. [Sell] Mycophenolic Acid
    
14. [Sell] Ascomycin (FK520)
    
15. [Sell] Mizoribine
    
16. [Sell] Mycophenolate Mofetil
    
17. [Sell] Sirolimus(Rapamycin)
    
18. [Sell] Tacrolimus (FK506)
    
19. [Sell] Cyclosporine(ciclosporin)
    
20. [Sell] Pimecrolimus